C23H29NO3 — CID 11451452
(1R,3S,4R,5S,8S,11R)-4-(furan-2-yl)-7,7,11-trimethyl-5-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol (PubChem CID 11451452) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (1R,3S,4R,5S,8S,11R)-4-(furan-2-yl)-7,7,11-trimethyl-5-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol.
| Compound Name | (1R,3S,4R,5S,8S,11R)-4-(furan-2-yl)-7,7,11-trimethyl-5-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol |
|---|---|
| PubChem CID | 11451452 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (1R,3S,4R,5S,8S,11R)-4-(furan-2-yl)-7,7,11-trimethyl-5-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]1N([C@@H](c3ccccc3)[C@@]1(O)c1ccco1)C2(C)C |
| InChI | InChI=1S/C23H29NO3/c1-15-11-12-17-18(14-15)27-21-23(25,19-10-7-13-26-19)20(24(21)22(17,2)3)16-8-5-4-6-9-16/h4-10,13,15,17-18,20-21,25H,11-12,14H2,1-3H3/t15-,17-,18-,20+,21+,23+/m1/s1 |
| InChIKey | LPRRJMGXXWHTFR-DSLXZWMUSA-N |
| XLogP | 4.46 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |