C25H37NO2 — CID 11991838
(3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-phenylspiro[9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane-13,1'-cyclohexane] (PubChem CID 11991838) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-phenylspiro[9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane-13,1'-cyclohexane].
| Compound Name | (3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-phenylspiro[9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane-13,1'-cyclohexane] |
|---|---|
| PubChem CID | 11991838 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-phenylspiro[9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane-13,1'-cyclohexane] |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H](c3ccccc3)OC3(CCCCC3)CN1C2(C)C |
| InChI | InChI=1S/C25H37NO2/c1-18-12-13-20-21(16-18)27-23-22(19-10-6-4-7-11-19)28-25(14-8-5-9-15-25)17-26(23)24(20,2)3/h4,6-7,10-11,18,20-23H,5,8-9,12-17H2,1-3H3/t18-,20-,21-,22+,23+/m1/s1 |
| InChIKey | GMKPTVOETLHJIO-FXILAVBZSA-N |
| XLogP | 5.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |