C27H35NO4 — CID 11259170
(1R,3S,4S,5S,8S,11R)-5-(3,4-dimethoxyphenyl)-7,7,11-trimethyl-4-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol (PubChem CID 11259170) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (1R,3S,4S,5S,8S,11R)-5-(3,4-dimethoxyphenyl)-7,7,11-trimethyl-4-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol.
| Compound Name | (1R,3S,4S,5S,8S,11R)-5-(3,4-dimethoxyphenyl)-7,7,11-trimethyl-4-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol |
|---|---|
| PubChem CID | 11259170 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (1R,3S,4S,5S,8S,11R)-5-(3,4-dimethoxyphenyl)-7,7,11-trimethyl-4-phenyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol |
| SMILES | COc1ccc([C@@H]2N3[C@@H](O[C@@H]4C[C@H](C)CC[C@H]4C3(C)C)[C@]2(O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H35NO4/c1-17-11-13-20-22(15-17)32-25-27(29,19-9-7-6-8-10-19)24(28(25)26(20,2)3)18-12-14-21(30-4)23(16-18)31-5/h6-10,12,14,16-17,20,22,24-25,29H,11,13,15H2,1-5H3/t17-,20-,22-,24+,25+,27+/m1/s1 |
| InChIKey | GDTVPSHFVIYUTN-MRTVJQLFSA-N |
| XLogP | 4.89 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |