C29H37N3O2 — CID 12966644
1-[(3S,6R,8R,10S,11R,14R,15S)-2,2,6-trimethyl-12,14-diphenyl-9-oxa-1,12,13-triazatetracyclo[8.6.0.03,8.011,15]hexadecan-13-yl]ethanone (PubChem CID 12966644) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is 1-[(3S,6R,8R,10S,11R,14R,15S)-2,2,6-trimethyl-12,14-diphenyl-9-oxa-1,12,13-triazatetracyclo[8.6.0.03,8.011,15]hexadecan-13-yl]ethanone.
| Compound Name | 1-[(3S,6R,8R,10S,11R,14R,15S)-2,2,6-trimethyl-12,14-diphenyl-9-oxa-1,12,13-triazatetracyclo[8.6.0.03,8.011,15]hexadecan-13-yl]ethanone |
|---|---|
| PubChem CID | 12966644 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 1-[(3S,6R,8R,10S,11R,14R,15S)-2,2,6-trimethyl-12,14-diphenyl-9-oxa-1,12,13-triazatetracyclo[8.6.0.03,8.011,15]hexadecan-13-yl]ethanone |
| SMILES | CC(=O)N1[C@@H](c2ccccc2)[C@@H]2CN3[C@@H](O[C@@H]4C[C@H](C)CC[C@H]4C3(C)C)[C@@H]2N1c1ccccc1 |
| InChI | InChI=1S/C29H37N3O2/c1-19-15-16-24-25(17-19)34-28-27-23(18-30(28)29(24,3)4)26(21-11-7-5-8-12-21)31(20(2)33)32(27)22-13-9-6-10-14-22/h5-14,19,23-28H,15-18H2,1-4H3/t19-,23+,24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | VZCVCAGVQDSCHP-OUOQFZKZSA-N |
| XLogP | 5.25 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |