C16H29NO — CID 10753264
(1R,3S,5S,9S,12R)-5-ethyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane (PubChem CID 10753264) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (1R,3S,5S,9S,12R)-5-ethyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane.
| Compound Name | (1R,3S,5S,9S,12R)-5-ethyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane |
|---|---|
| PubChem CID | 10753264 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (1R,3S,5S,9S,12R)-5-ethyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane |
| SMILES | CC[C@H]1C[C@@H]2O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)N2C1 |
| InChI | InChI=1S/C16H29NO/c1-5-12-9-15-17(10-12)16(3,4)13-7-6-11(2)8-14(13)18-15/h11-15H,5-10H2,1-4H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | QNCWWJSXXYHGFG-KHMAMNHCSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |