C20H19NO6 — CID 102354322
3-hydroxy-4-[(1S,2R)-1-methoxy-1-(4-nitrophenyl)propan-2-yl]-2-phenyl-2H-furan-5-one (PubChem CID 102354322) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-hydroxy-4-[(1S,2R)-1-methoxy-1-(4-nitrophenyl)propan-2-yl]-2-phenyl-2H-furan-5-one.
| Compound Name | 3-hydroxy-4-[(1S,2R)-1-methoxy-1-(4-nitrophenyl)propan-2-yl]-2-phenyl-2H-furan-5-one |
|---|---|
| PubChem CID | 102354322 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-hydroxy-4-[(1S,2R)-1-methoxy-1-(4-nitrophenyl)propan-2-yl]-2-phenyl-2H-furan-5-one |
| SMILES | CO[C@H](c1ccc([N+](=O)[O-])cc1)[C@H](C)C1=C(O)C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C20H19NO6/c1-12(18(26-2)14-8-10-15(11-9-14)21(24)25)16-17(22)19(27-20(16)23)13-6-4-3-5-7-13/h3-12,18-19,22H,1-2H3/t12-,18+,19?/m1/s1 |
| InChIKey | BCOFDDIIRGPUGI-RRJYNFDQSA-N |
| XLogP | 4.03 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|