C16H16ClNO3 — CID 101391114
(1S,2S,3S)-3-chloro-2-methyl-1-(4-nitrophenyl)-3-phenylpropan-1-ol (PubChem CID 101391114) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is (1S,2S,3S)-3-chloro-2-methyl-1-(4-nitrophenyl)-3-phenylpropan-1-ol.
| Compound Name | (1S,2S,3S)-3-chloro-2-methyl-1-(4-nitrophenyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101391114 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (1S,2S,3S)-3-chloro-2-methyl-1-(4-nitrophenyl)-3-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccc([N+](=O)[O-])cc1)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO3/c1-11(15(17)12-5-3-2-4-6-12)16(19)13-7-9-14(10-8-13)18(20)21/h2-11,15-16,19H,1H3/t11-,15+,16+/m1/s1 |
| InChIKey | QUUORZVZINRLNQ-RLCCDNCMSA-N |
| XLogP | 4.24 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|