C17H22N2O6S — CID 174686694
2-(ethylamino)-2-(4-nitrophenyl)-1-phenylethanol;methanesulfonic acid (PubChem CID 174686694) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-(ethylamino)-2-(4-nitrophenyl)-1-phenylethanol;methanesulfonic acid.
| Compound Name | 2-(ethylamino)-2-(4-nitrophenyl)-1-phenylethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 174686694 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(ethylamino)-2-(4-nitrophenyl)-1-phenylethanol;methanesulfonic acid |
| SMILES | CCNC(c1ccc([N+](=O)[O-])cc1)C(O)c1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C16H18N2O3.CH4O3S/c1-2-17-15(16(19)13-6-4-3-5-7-13)12-8-10-14(11-9-12)18(20)21;1-5(2,3)4/h3-11,15-17,19H,2H2,1H3;1H3,(H,2,3,4) |
| InChIKey | DBBRRJRQUQIJAX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|