About dimethyldiazene;methanesulfonic acid;nitrobenzene
dimethyldiazene;methanesulfonic acid;nitrobenzene (PubChem CID 175242029) has the molecular formula C9H15N3O5S
and a molecular weight of 277.30 g/mol. Its IUPAC name is dimethyldiazene;methanesulfonic acid;nitrobenzene.
Molecular Properties
| Compound Name | dimethyldiazene;methanesulfonic acid;nitrobenzene |
| PubChem CID | 175242029 |
| Molecular Formula | C9H15N3O5S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | dimethyldiazene;methanesulfonic acid;nitrobenzene |
| SMILES | C/N=N/C.CS(=O)(=O)O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C2H6N2.CH4O3S/c8-7(9)6-4-2-1-3-5-6;1-3-4-2;1-5(2,3)4/h1-5H;1-2H3;1H3,(H,2,3,4)/b;4-3+; |
| InChIKey | WIHBEKHPEGKECX-ITDJAWRYSA-N |
| XLogP | 1.80 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyldiazene;methanesulfonic acid;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyldiazene;methanesulfonic acid;nitrobenzene?
The IUPAC name of dimethyldiazene;methanesulfonic acid;nitrobenzene (CID 175242029) is dimethyldiazene;methanesulfonic acid;nitrobenzene.
What is the SMILES notation for dimethyldiazene;methanesulfonic acid;nitrobenzene?
The canonical SMILES for dimethyldiazene;methanesulfonic acid;nitrobenzene is C/N=N/C.CS(=O)(=O)O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of dimethyldiazene;methanesulfonic acid;nitrobenzene?
The InChIKey is WIHBEKHPEGKECX-ITDJAWRYSA-N. The full InChI is InChI=1S/C6H5NO2.C2H6N2.CH4O3S/c8-7(9)6-4-2-1-3-5-6;1-3-4-2;1-5(2,3)4/h1-5H;1-2H3;1H3,(H,2,3,4)/b;4-3+;.
What are the key properties of dimethyldiazene;methanesulfonic acid;nitrobenzene?
dimethyldiazene;methanesulfonic acid;nitrobenzene has a molecular weight of 277.30 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyldiazene;methanesulfonic acid;nitrobenzene is sourced from PubChem (CID 175242029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).