C12H16N2O7S — CID 40525520
ethyl (2R,3S)-3-hydroxy-2-(methanesulfonamido)-3-(4-nitrophenyl)propanoate (PubChem CID 40525520) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is ethyl (2R,3S)-3-hydroxy-2-(methanesulfonamido)-3-(4-nitrophenyl)propanoate.
| Compound Name | ethyl (2R,3S)-3-hydroxy-2-(methanesulfonamido)-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 40525520 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | ethyl (2R,3S)-3-hydroxy-2-(methanesulfonamido)-3-(4-nitrophenyl)propanoate |
| SMILES | CCOC(=O)[C@H](NS(C)(=O)=O)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H16N2O7S/c1-3-21-12(16)10(13-22(2,19)20)11(15)8-4-6-9(7-5-8)14(17)18/h4-7,10-11,13,15H,3H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | FASRUFVROBYRCC-MNOVXSKESA-N |
| XLogP | 0.11 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|