C12H13NO5 — CID 124637865
ethyl (E,4R)-4-hydroxy-4-(4-nitrophenyl)but-2-enoate (PubChem CID 124637865) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is ethyl (E,4R)-4-hydroxy-4-(4-nitrophenyl)but-2-enoate.
| Compound Name | ethyl (E,4R)-4-hydroxy-4-(4-nitrophenyl)but-2-enoate |
|---|---|
| PubChem CID | 124637865 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | ethyl (E,4R)-4-hydroxy-4-(4-nitrophenyl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H13NO5/c1-2-18-12(15)8-7-11(14)9-3-5-10(6-4-9)13(16)17/h3-8,11,14H,2H2,1H3/b8-7+/t11-/m1/s1 |
| InChIKey | YLUMDDCPMFKSKH-WSKFYRRCSA-N |
| XLogP | 1.75 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|