C20H17NO9 — CID 57215100
2-[2-[4-hydroxy-4-(4-nitrophenyl)but-2-enoyl]oxycarbonyl-4-methoxyphenyl]acetic acid (PubChem CID 57215100) has the molecular formula C20H17NO9 and a molecular weight of 415.35 g/mol. Its IUPAC name is 2-[2-[4-hydroxy-4-(4-nitrophenyl)but-2-enoyl]oxycarbonyl-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[2-[4-hydroxy-4-(4-nitrophenyl)but-2-enoyl]oxycarbonyl-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 57215100 |
| Molecular Formula | C20H17NO9 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[2-[4-hydroxy-4-(4-nitrophenyl)but-2-enoyl]oxycarbonyl-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)c(C(=O)OC(=O)C=CC(O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C20H17NO9/c1-29-15-7-4-13(10-18(23)24)16(11-15)20(26)30-19(25)9-8-17(22)12-2-5-14(6-3-12)21(27)28/h2-9,11,17,22H,10H2,1H3,(H,23,24) |
| InChIKey | HCFJBAZJBILTDJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|