C21H28N2O6 — CID 132849566
(4S)-3-[(E,4S,5R)-5-methoxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 132849566) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is (4S)-3-[(E,4S,5R)-5-methoxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,4S,5R)-5-methoxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132849566 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (4S)-3-[(E,4S,5R)-5-methoxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CO[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H](C)/C=C/C(=O)N1C(=O)OC(C)(C)[C@@H]1C(C)C |
| InChI | InChI=1S/C21H28N2O6/c1-13(2)19-21(4,5)29-20(25)22(19)17(24)12-7-14(3)18(28-6)15-8-10-16(11-9-15)23(26)27/h7-14,18-19H,1-6H3/b12-7+/t14-,18+,19-/m0/s1 |
| InChIKey | OCRIOHFHLDZVPV-UNZBGCJCSA-N |
| XLogP | 4.26 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|