C16H27NO4 — CID 132849567
(4S)-3-[(E,4S,5S)-5-methoxy-4-methylhex-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 132849567) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is (4S)-3-[(E,4S,5S)-5-methoxy-4-methylhex-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,4S,5S)-5-methoxy-4-methylhex-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132849567 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (4S)-3-[(E,4S,5S)-5-methoxy-4-methylhex-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CO[C@@H](C)[C@@H](C)/C=C/C(=O)N1C(=O)OC(C)(C)[C@@H]1C(C)C |
| InChI | InChI=1S/C16H27NO4/c1-10(2)14-16(5,6)21-15(19)17(14)13(18)9-8-11(3)12(4)20-7/h8-12,14H,1-7H3/b9-8+/t11-,12-,14-/m0/s1 |
| InChIKey | WWBINOMFMJVIEC-VFOUYEJOSA-N |
| XLogP | 3.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|