C36H44N2O6Si — CID 132992429
3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 132992429) has the molecular formula C36H44N2O6Si and a molecular weight of 628.84 g/mol. Its IUPAC name is 3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132992429 |
| Molecular Formula | C36H44N2O6Si |
| Molecular Weight | 628.84 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(4-nitrophenyl)pent-2-enoyl]-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)C1N(C(=O)/C=C/[C@H](C)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2ccc([N+](=O)[O-])cc2)C(=O)OC1(C)C |
| InChI | InChI=1S/C36H44N2O6Si/c1-25(2)33-36(7,8)43-34(40)37(33)31(39)24-19-26(3)32(27-20-22-28(23-21-27)38(41)42)44-45(35(4,5)6,29-15-11-9-12-16-29)30-17-13-10-14-18-30/h9-26,32-33H,1-8H3/b24-19+/t26-,32+,33?/m0/s1 |
| InChIKey | XIBREUMTUIHAJC-DBRGBPLSSA-N |
| XLogP | 7.19 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.84 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|