C28H40N2O3Si — CID 140703040
(4R,5S)-4-[(1R)-1-aminoethyl]-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-3-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 140703040) has the molecular formula C28H40N2O3Si and a molecular weight of 480.73 g/mol. Its IUPAC name is (4R,5S)-4-[(1R)-1-aminoethyl]-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-3-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-[(1R)-1-aminoethyl]-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-3-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 140703040 |
| Molecular Formula | C28H40N2O3Si |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (4R,5S)-4-[(1R)-1-aminoethyl]-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-3-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCN1C(=O)O[C@](C)([C@@H](CC)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1[C@@H](C)N |
| InChI | InChI=1S/C28H40N2O3Si/c1-8-20-30-25(21(3)29)28(7,32-26(30)31)24(9-2)33-34(27(4,5)6,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h8,10-19,21,24-25H,1,9,20,29H2,2-7H3/t21-,24-,25-,28-/m1/s1 |
| InChIKey | ZIHKBYWWPMWAEX-VGSCBBJJSA-N |
| XLogP | 4.45 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|