C29H40N4O4Si — CID 140702964
(4S,5S)-4-acetyl-3-(4-azidobutyl)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 140702964) has the molecular formula C29H40N4O4Si and a molecular weight of 536.75 g/mol. Its IUPAC name is (4S,5S)-4-acetyl-3-(4-azidobutyl)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-4-acetyl-3-(4-azidobutyl)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 140702964 |
| Molecular Formula | C29H40N4O4Si |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (4S,5S)-4-acetyl-3-(4-azidobutyl)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@]1(C)OC(=O)N(CCCCN=[N+]=[N-])[C@@H]1C(C)=O |
| InChI | InChI=1S/C29H40N4O4Si/c1-7-25(29(6)26(22(2)34)33(27(35)36-29)21-15-14-20-31-32-30)37-38(28(3,4)5,23-16-10-8-11-17-23)24-18-12-9-13-19-24/h8-13,16-19,25-26H,7,14-15,20-21H2,1-6H3/t25-,26-,29-/m1/s1 |
| InChIKey | QUCLATWDDSISOB-WWPJHQMMSA-N |
| XLogP | 5.60 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|