C76H82N2O6Si2 — CID 139049588
(4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 139049588) has the molecular formula C76H82N2O6Si2 and a molecular weight of 1175.67 g/mol. Its IUPAC name is (4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139049588 |
| Molecular Formula | C76H82N2O6Si2 |
| Molecular Weight | 1175.67 g/mol |
| Exact Mass | 1174.57 |
| IUPAC Name | (4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C(\O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C.C=C/C=C(\O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C |
| InChI | InChI=1S/2C38H41NO3Si/c2*1-7-20-34(42-43(37(4,5)6,32-25-16-10-17-26-32)33-27-18-11-19-28-33)39-35(29(2)3)38(41-36(39)40,30-21-12-8-13-22-30)31-23-14-9-15-24-31/h2*7-29,35H,1H2,2-6H3/b2*34-20-/t2*35-/m00/s1 |
| InChIKey | OIAHDKYJQYMGTA-CXSOGOPNSA-N |
| XLogP | 16.02 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.67 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|