C29H26N2O5 — CID 85319366
2-[3-oxo-3-(2-oxo-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-3-yl)propyl]isoindole-1,3-dione (PubChem CID 85319366) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[3-oxo-3-(2-oxo-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-3-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-oxo-3-(2-oxo-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-3-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 85319366 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-[3-oxo-3-(2-oxo-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-3-yl)propyl]isoindole-1,3-dione |
| SMILES | CC(C)C1N(C(=O)CCN2C(=O)c3ccccc3C2=O)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O5/c1-19(2)25-29(20-11-5-3-6-12-20,21-13-7-4-8-14-21)36-28(35)31(25)24(32)17-18-30-26(33)22-15-9-10-16-23(22)27(30)34/h3-16,19,25H,17-18H2,1-2H3 |
| InChIKey | TZGCYHHNWNTNSS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|