C31H34N2O8SSi — CID 88706528
S-[(3S)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxoazetidin-1-yl] 2-[tert-butyl(diphenyl)silyl]oxyethanethioate (PubChem CID 88706528) has the molecular formula C31H34N2O8SSi and a molecular weight of 622.77 g/mol. Its IUPAC name is S-[(3S)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxoazetidin-1-yl] 2-[tert-butyl(diphenyl)silyl]oxyethanethioate.
| Compound Name | S-[(3S)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxoazetidin-1-yl] 2-[tert-butyl(diphenyl)silyl]oxyethanethioate |
|---|---|
| PubChem CID | 88706528 |
| Molecular Formula | C31H34N2O8SSi |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | S-[(3S)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxoazetidin-1-yl] 2-[tert-butyl(diphenyl)silyl]oxyethanethioate |
| SMILES | C[C@@H](OC(=O)OCc1ccc([N+](=O)[O-])cc1)[C@@H]1CN(SC(=O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C31H34N2O8SSi/c1-22(41-30(36)39-20-23-15-17-24(18-16-23)33(37)38)27-19-32(29(27)35)42-28(34)21-40-43(31(2,3)4,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-18,22,27H,19-21H2,1-4H3/t22-,27+/m1/s1 |
| InChIKey | FMIUTLLDTJDGJS-AMGIVPHBSA-N |
| XLogP | 4.85 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|