C38H40N2O8Si — CID 54222194
(4-nitrophenyl)methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-4-[tert-butyl(diphenyl)silyl]oxybutanoate (PubChem CID 54222194) has the molecular formula C38H40N2O8Si and a molecular weight of 680.83 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-4-[tert-butyl(diphenyl)silyl]oxybutanoate.
| Compound Name | (4-nitrophenyl)methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-4-[tert-butyl(diphenyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 54222194 |
| Molecular Formula | C38H40N2O8Si |
| Molecular Weight | 680.83 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-4-[tert-butyl(diphenyl)silyl]oxybutanoate |
| SMILES | CC(=O)OC1C(=O)N(C(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)OCc2ccc([N+](=O)[O-])cc2)C1c1ccccc1 |
| InChI | InChI=1S/C38H40N2O8Si/c1-27(41)48-35-34(29-14-8-5-9-15-29)39(36(35)42)33(37(43)46-26-28-20-22-30(23-21-28)40(44)45)24-25-47-49(38(2,3)4,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-23,33-35H,24-26H2,1-4H3 |
| InChIKey | QDJMBSINVVXGSM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|