C32H37NO7Si — CID 19090357
methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-3-[(2-methylpropan-2-yl)oxy-diphenylsilyl]oxybutanoate (PubChem CID 19090357) has the molecular formula C32H37NO7Si and a molecular weight of 575.73 g/mol. Its IUPAC name is methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-3-[(2-methylpropan-2-yl)oxy-diphenylsilyl]oxybutanoate.
| Compound Name | methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-3-[(2-methylpropan-2-yl)oxy-diphenylsilyl]oxybutanoate |
|---|---|
| PubChem CID | 19090357 |
| Molecular Formula | C32H37NO7Si |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | methyl 2-(3-acetyloxy-2-oxo-4-phenylazetidin-1-yl)-3-[(2-methylpropan-2-yl)oxy-diphenylsilyl]oxybutanoate |
| SMILES | COC(=O)C(C(C)O[Si](OC(C)(C)C)(c1ccccc1)c1ccccc1)N1C(=O)C(OC(C)=O)C1c1ccccc1 |
| InChI | InChI=1S/C32H37NO7Si/c1-22(39-41(40-32(3,4)5,25-18-12-8-13-19-25)26-20-14-9-15-21-26)27(31(36)37-6)33-28(24-16-10-7-11-17-24)29(30(33)35)38-23(2)34/h7-22,27-29H,1-6H3 |
| InChIKey | JIPZTNGDNLLBGR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|