C17H15NO3S — CID 102078289
[(3S,4S)-2-oxo-4-phenyl-1-phenylsulfanylazetidin-3-yl] acetate (PubChem CID 102078289) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is [(3S,4S)-2-oxo-4-phenyl-1-phenylsulfanylazetidin-3-yl] acetate.
| Compound Name | [(3S,4S)-2-oxo-4-phenyl-1-phenylsulfanylazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 102078289 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | [(3S,4S)-2-oxo-4-phenyl-1-phenylsulfanylazetidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)N(Sc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO3S/c1-12(19)21-16-15(13-8-4-2-5-9-13)18(17(16)20)22-14-10-6-3-7-11-14/h2-11,15-16H,1H3/t15-,16-/m0/s1 |
| InChIKey | LCEYMPUQUJPNGF-HOTGVXAUSA-N |
| XLogP | 3.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|