C19H17NO5S — CID 102078294
methyl 4-[(2S,3S)-3-acetyloxy-4-oxo-1-phenylsulfanylazetidin-2-yl]benzoate (PubChem CID 102078294) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is methyl 4-[(2S,3S)-3-acetyloxy-4-oxo-1-phenylsulfanylazetidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,3S)-3-acetyloxy-4-oxo-1-phenylsulfanylazetidin-2-yl]benzoate |
|---|---|
| PubChem CID | 102078294 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | methyl 4-[(2S,3S)-3-acetyloxy-4-oxo-1-phenylsulfanylazetidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2[C@H](OC(C)=O)C(=O)N2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO5S/c1-12(21)25-17-16(13-8-10-14(11-9-13)19(23)24-2)20(18(17)22)26-15-6-4-3-5-7-15/h3-11,16-17H,1-2H3/t16-,17-/m0/s1 |
| InChIKey | XXNLNBUIXBBEFF-IRXDYDNUSA-N |
| XLogP | 3.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|