C13H13NO4 — CID 56838601
(1R,3R,4R,6R)-4-methyl-3-(4-nitrophenyl)-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 56838601) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (1R,3R,4R,6R)-4-methyl-3-(4-nitrophenyl)-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,3R,4R,6R)-4-methyl-3-(4-nitrophenyl)-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 56838601 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (1R,3R,4R,6R)-4-methyl-3-(4-nitrophenyl)-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | C[C@@H]1C[C@H]2O[C@H]2C(=O)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13NO4/c1-7-6-10-13(18-10)12(15)11(7)8-2-4-9(5-3-8)14(16)17/h2-5,7,10-11,13H,6H2,1H3/t7-,10-,11-,13-/m1/s1 |
| InChIKey | VHWAMUADPGSZSP-GDECHXLSSA-N |
| XLogP | 2.05 |
| TPSA | 72.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|