C26H32BrNO — CID 135077366
(2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 135077366) has the molecular formula C26H32BrNO and a molecular weight of 454.45 g/mol. Its IUPAC name is (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 135077366 |
| Molecular Formula | C26H32BrNO |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CCC2C(C1)O[C@@H](c1ccccc1Br)N(C/C=C/c1ccccc1)C2(C)C |
| InChI | InChI=1S/C26H32BrNO/c1-19-15-16-22-24(18-19)29-25(21-13-7-8-14-23(21)27)28(26(22,2)3)17-9-12-20-10-5-4-6-11-20/h4-14,19,22,24-25H,15-18H2,1-3H3/b12-9+/t19-,22?,24?,25+/m1/s1 |
| InChIKey | UZGUOIQDAXRAQJ-MSFZYNAWSA-N |
| XLogP | 7.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |