C24H33NO3 — CID 53244058
(3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-[(Z)-4-phenylbut-1-enyl]-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one (PubChem CID 53244058) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-[(Z)-4-phenylbut-1-enyl]-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one.
| Compound Name | (3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-[(Z)-4-phenylbut-1-enyl]-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one |
|---|---|
| PubChem CID | 53244058 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (3S,6R,8R,10S,11S)-2,2,6-trimethyl-11-[(Z)-4-phenylbut-1-enyl]-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H](/C=C\CCc3ccccc3)OC(=O)CN1C2(C)C |
| InChI | InChI=1S/C24H33NO3/c1-17-13-14-19-21(15-17)28-23-20(27-22(26)16-25(23)24(19,2)3)12-8-7-11-18-9-5-4-6-10-18/h4-6,8-10,12,17,19-21,23H,7,11,13-16H2,1-3H3/b12-8-/t17-,19-,20+,21-,23+/m1/s1 |
| InChIKey | AGBKDLBVEDKRRN-MCKTZINRSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|