C20H16Br2O4 — CID 10696076
methyl (4S,4aS,9aS)-1,4-dibromo-3-oxo-4-phenyl-9,9a-dihydro-4aH-indeno[2,1-c]pyran-1-carboxylate (PubChem CID 10696076) has the molecular formula C20H16Br2O4 and a molecular weight of 480.15 g/mol. Its IUPAC name is methyl (4S,4aS,9aS)-1,4-dibromo-3-oxo-4-phenyl-9,9a-dihydro-4aH-indeno[2,1-c]pyran-1-carboxylate.
| Compound Name | methyl (4S,4aS,9aS)-1,4-dibromo-3-oxo-4-phenyl-9,9a-dihydro-4aH-indeno[2,1-c]pyran-1-carboxylate |
|---|---|
| PubChem CID | 10696076 |
| Molecular Formula | C20H16Br2O4 |
| Molecular Weight | 480.15 g/mol |
| Exact Mass | 477.94 |
| IUPAC Name | methyl (4S,4aS,9aS)-1,4-dibromo-3-oxo-4-phenyl-9,9a-dihydro-4aH-indeno[2,1-c]pyran-1-carboxylate |
| SMILES | COC(=O)C1(Br)OC(=O)[C@@](Br)(c2ccccc2)[C@@H]2c3ccccc3C[C@@H]21 |
| InChI | InChI=1S/C20H16Br2O4/c1-25-18(24)20(22)15-11-12-7-5-6-10-14(12)16(15)19(21,17(23)26-20)13-8-3-2-4-9-13/h2-10,15-16H,11H2,1H3/t15-,16+,19+,20?/m0/s1 |
| InChIKey | RKTHQBSJUDDUQF-ZOSRWAJXSA-N |
| XLogP | 4.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|