C25H24O — CID 132517967
(1R,4aS,10S,10aS)-1,10-diphenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene (PubChem CID 132517967) has the molecular formula C25H24O and a molecular weight of 340.47 g/mol. Its IUPAC name is (1R,4aS,10S,10aS)-1,10-diphenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene.
| Compound Name | (1R,4aS,10S,10aS)-1,10-diphenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene |
|---|---|
| PubChem CID | 132517967 |
| Molecular Formula | C25H24O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (1R,4aS,10S,10aS)-1,10-diphenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene |
| SMILES | c1ccc([C@H]2c3ccccc3C[C@H]3CCO[C@@H](c4ccccc4)[C@@H]32)cc1 |
| InChI | InChI=1S/C25H24O/c1-3-9-18(10-4-1)23-22-14-8-7-13-20(22)17-21-15-16-26-25(24(21)23)19-11-5-2-6-12-19/h1-14,21,23-25H,15-17H2/t21-,23+,24+,25+/m1/s1 |
| InChIKey | UPSRBFZWUGGNOE-VZVHPENPSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |