C25H23BrO — CID 132517956
(1R,4aS,10S,10aS)-1-(2-bromophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene (PubChem CID 132517956) has the molecular formula C25H23BrO and a molecular weight of 419.36 g/mol. Its IUPAC name is (1R,4aS,10S,10aS)-1-(2-bromophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene.
| Compound Name | (1R,4aS,10S,10aS)-1-(2-bromophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene |
|---|---|
| PubChem CID | 132517956 |
| Molecular Formula | C25H23BrO |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (1R,4aS,10S,10aS)-1-(2-bromophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene |
| SMILES | Brc1ccccc1[C@@H]1OCC[C@@H]2Cc3ccccc3[C@H](c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C25H23BrO/c26-22-13-7-6-12-21(22)25-24-19(14-15-27-25)16-18-10-4-5-11-20(18)23(24)17-8-2-1-3-9-17/h1-13,19,23-25H,14-16H2/t19-,23+,24+,25+/m1/s1 |
| InChIKey | PHSKUGCHBMNPMC-RYCFVGSHSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |