C11H16O5Si — CID 123595978
5-(dimethoxymethylsilyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 123595978) has the molecular formula C11H16O5Si and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-(dimethoxymethylsilyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-(dimethoxymethylsilyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 123595978 |
| Molecular Formula | C11H16O5Si |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-(dimethoxymethylsilyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | COC(OC)[SiH2]C1=CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C11H16O5Si/c1-14-11(15-2)17-6-3-4-7-8(5-6)10(13)16-9(7)12/h3,7-8,11H,4-5,17H2,1-2H3 |
| InChIKey | WTDBMQMJXCAMPQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|