C9H16O5Si — CID 154407791
3-[2-(dimethoxymethylsilyl)ethyl]oxolane-2,5-dione (PubChem CID 154407791) has the molecular formula C9H16O5Si and a molecular weight of 232.31 g/mol. Its IUPAC name is 3-[2-(dimethoxymethylsilyl)ethyl]oxolane-2,5-dione.
| Compound Name | 3-[2-(dimethoxymethylsilyl)ethyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 154407791 |
| Molecular Formula | C9H16O5Si |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-[2-(dimethoxymethylsilyl)ethyl]oxolane-2,5-dione |
| SMILES | COC(OC)[SiH2]CCC1CC(=O)OC1=O |
| InChI | InChI=1S/C9H16O5Si/c1-12-9(13-2)15-4-3-6-5-7(10)14-8(6)11/h6,9H,3-5,15H2,1-2H3 |
| InChIKey | WEAPPQXLVDYFEI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|