C13H24O5Si — CID 172816330
3-[3-(2,2-diethoxyethylsilyl)propyl]oxolane-2,5-dione (PubChem CID 172816330) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-[3-(2,2-diethoxyethylsilyl)propyl]oxolane-2,5-dione.
| Compound Name | 3-[3-(2,2-diethoxyethylsilyl)propyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 172816330 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[3-(2,2-diethoxyethylsilyl)propyl]oxolane-2,5-dione |
| SMILES | CCOC(C[SiH2]CCCC1CC(=O)OC1=O)OCC |
| InChI | InChI=1S/C13H24O5Si/c1-3-16-12(17-4-2)9-19-7-5-6-10-8-11(14)18-13(10)15/h10,12H,3-9,19H2,1-2H3 |
| InChIKey | SVZSRAHNZLOMMQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|