C8H6O4 — CID 102399160
(3aS,6aS)-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]furan-4-carbaldehyde (PubChem CID 102399160) has the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. Its IUPAC name is (3aS,6aS)-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]furan-4-carbaldehyde.
| Compound Name | (3aS,6aS)-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]furan-4-carbaldehyde |
|---|---|
| PubChem CID | 102399160 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | (3aS,6aS)-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]furan-4-carbaldehyde |
| SMILES | O=CC1=CC[C@@H]2C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C8H6O4/c9-3-4-1-2-5-6(4)8(11)12-7(5)10/h1,3,5-6H,2H2/t5-,6+/m0/s1 |
| InChIKey | LAUIVKIBSMNSPI-NTSWFWBYSA-N |
| XLogP | -0.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|