C9H10MgO3 — CID 175974408
CID 175974408 (PubChem CID 175974408) has the molecular formula C9H10MgO3 and a molecular weight of 190.48 g/mol.
| Compound Name | CID 175974408 |
|---|---|
| PubChem CID | 175974408 |
| Molecular Formula | C9H10MgO3 |
| Molecular Weight | 190.48 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | — |
| SMILES | CC1=CCCC2C(=O)OC(=O)C12.[Mg] |
| InChI | InChI=1S/C9H10O3.Mg/c1-5-3-2-4-6-7(5)9(11)12-8(6)10;/h3,6-7H,2,4H2,1H3; |
| InChIKey | FQYJXJYVLUIRBU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.48 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|