C10H12O3 — CID 98116507
(3aS,7aR)-6,7-dimethyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 98116507) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (3aS,7aR)-6,7-dimethyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,7aR)-6,7-dimethyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 98116507 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (3aS,7aR)-6,7-dimethyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC1=C(C)[C@@H]2C(=O)OC(=O)[C@H]2CC1 |
| InChI | InChI=1S/C10H12O3/c1-5-3-4-7-8(6(5)2)10(12)13-9(7)11/h7-8H,3-4H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | PDQQMXWVVOPGQR-YUMQZZPRSA-N |
| XLogP | 1.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|