C15H15NO — CID 122205849
(9aR)-7-phenyl-3,6,9,9a-tetrahydroquinolizin-4-one (PubChem CID 122205849) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (9aR)-7-phenyl-3,6,9,9a-tetrahydroquinolizin-4-one.
| Compound Name | (9aR)-7-phenyl-3,6,9,9a-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 122205849 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (9aR)-7-phenyl-3,6,9,9a-tetrahydroquinolizin-4-one |
| SMILES | O=C1CC=C[C@H]2CC=C(c3ccccc3)CN12 |
| InChI | InChI=1S/C15H15NO/c17-15-8-4-7-14-10-9-13(11-16(14)15)12-5-2-1-3-6-12/h1-7,9,14H,8,10-11H2/t14-/m0/s1 |
| InChIKey | PHBPJYJGMYBIRD-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|