C24H26O — CID 143708381
4-(3-methylphenyl)-1-(5-phenylcyclohepta-2,5-dien-1-yl)butan-2-one (PubChem CID 143708381) has the molecular formula C24H26O and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-(3-methylphenyl)-1-(5-phenylcyclohepta-2,5-dien-1-yl)butan-2-one.
| Compound Name | 4-(3-methylphenyl)-1-(5-phenylcyclohepta-2,5-dien-1-yl)butan-2-one |
|---|---|
| PubChem CID | 143708381 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 4-(3-methylphenyl)-1-(5-phenylcyclohepta-2,5-dien-1-yl)butan-2-one |
| SMILES | Cc1cccc(CCC(=O)CC2C=CCC(c3ccccc3)=CC2)c1 |
| InChI | InChI=1S/C24H26O/c1-19-7-5-8-20(17-19)14-16-24(25)18-21-9-6-12-23(15-13-21)22-10-3-2-4-11-22/h2-11,15,17,21H,12-14,16,18H2,1H3 |
| InChIKey | IIZPFLOJSTWBHJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|