C9H11NO — CID 122205839
(9aR)-3,6,9,9a-tetrahydroquinolizin-4-one (PubChem CID 122205839) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (9aR)-3,6,9,9a-tetrahydroquinolizin-4-one.
| Compound Name | (9aR)-3,6,9,9a-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 122205839 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (9aR)-3,6,9,9a-tetrahydroquinolizin-4-one |
| SMILES | O=C1CC=C[C@H]2CC=CCN12 |
| InChI | InChI=1S/C9H11NO/c11-9-6-3-5-8-4-1-2-7-10(8)9/h1-3,5,8H,4,6-7H2/t8-/m1/s1 |
| InChIKey | KDWVBPACDDKAQB-MRVPVSSYSA-N |
| XLogP | 1.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|