C11H15NO — CID 135077533
(2S)-1,2-bis(prop-2-enyl)-2,5-dihydropyridin-6-one (PubChem CID 135077533) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2S)-1,2-bis(prop-2-enyl)-2,5-dihydropyridin-6-one.
| Compound Name | (2S)-1,2-bis(prop-2-enyl)-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 135077533 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2S)-1,2-bis(prop-2-enyl)-2,5-dihydropyridin-6-one |
| SMILES | C=CC[C@H]1C=CCC(=O)N1CC=C |
| InChI | InChI=1S/C11H15NO/c1-3-6-10-7-5-8-11(13)12(10)9-4-2/h3-5,7,10H,1-2,6,8-9H2/t10-/m0/s1 |
| InChIKey | WGXDILSNBPFJJB-JTQLQIEISA-N |
| XLogP | 1.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|