C9H13NO — CID 10511022
1-methyl-2-prop-2-enyl-2,3-dihydropyridin-6-one (PubChem CID 10511022) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-methyl-2-prop-2-enyl-2,3-dihydropyridin-6-one.
| Compound Name | 1-methyl-2-prop-2-enyl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 10511022 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-methyl-2-prop-2-enyl-2,3-dihydropyridin-6-one |
| SMILES | C=CCC1CC=CC(=O)N1C |
| InChI | InChI=1S/C9H13NO/c1-3-5-8-6-4-7-9(11)10(8)2/h3-4,7-8H,1,5-6H2,2H3 |
| InChIKey | REGALXJTOCQWAF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|