C7H11NO — CID 12662945
1,2-dimethyl-2,3-dihydropyridin-6-one (PubChem CID 12662945) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,2-dimethyl-2,3-dihydropyridin-6-one.
| Compound Name | 1,2-dimethyl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 12662945 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 1,2-dimethyl-2,3-dihydropyridin-6-one |
| SMILES | CC1CC=CC(=O)N1C |
| InChI | InChI=1S/C7H11NO/c1-6-4-3-5-7(9)8(6)2/h3,5-6H,4H2,1-2H3 |
| InChIKey | UJRBQFZBFAUOET-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |