C8H11NO — CID 118908019
(3Z,6Z)-1-methyl-2,5-dihydroazocin-8-one (PubChem CID 118908019) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (3Z,6Z)-1-methyl-2,5-dihydroazocin-8-one.
| Compound Name | (3Z,6Z)-1-methyl-2,5-dihydroazocin-8-one |
|---|---|
| PubChem CID | 118908019 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (3Z,6Z)-1-methyl-2,5-dihydroazocin-8-one |
| SMILES | CN1C/C=C\C/C=C\C1=O |
| InChI | InChI=1S/C8H11NO/c1-9-7-5-3-2-4-6-8(9)10/h3-6H,2,7H2,1H3/b5-3-,6-4- |
| InChIKey | HAYQNNJYERZREV-GLIMQPGKSA-N |
| XLogP | 0.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|