C6H10N2O — CID 93499476
(2S)-2,3-dimethyl-1,2-dihydropyrimidin-4-one (PubChem CID 93499476) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1,2-dihydropyrimidin-4-one.
| Compound Name | (2S)-2,3-dimethyl-1,2-dihydropyrimidin-4-one |
|---|---|
| PubChem CID | 93499476 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (2S)-2,3-dimethyl-1,2-dihydropyrimidin-4-one |
| SMILES | C[C@H]1NC=CC(=O)N1C |
| InChI | InChI=1S/C6H10N2O/c1-5-7-4-3-6(9)8(5)2/h3-5,7H,1-2H3/t5-/m0/s1 |
| InChIKey | GWNYQWIXDKJVOI-YFKPBYRVSA-N |
| XLogP | -0.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |