C16H18O3 — CID 135069444
(5E)-8-acetyl-6-phenyl-3,4,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 135069444) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (5E)-8-acetyl-6-phenyl-3,4,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (5E)-8-acetyl-6-phenyl-3,4,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 135069444 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (5E)-8-acetyl-6-phenyl-3,4,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CC(=O)C1C/C(c2ccccc2)=C\CCCOC1=O |
| InChI | InChI=1S/C16H18O3/c1-12(17)15-11-14(13-7-3-2-4-8-13)9-5-6-10-19-16(15)18/h2-4,7-9,15H,5-6,10-11H2,1H3/b14-9+ |
| InChIKey | HPQLTQHDHLZOKQ-NTEUORMPSA-N |
| XLogP | 3.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|