About trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate
trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate (PubChem CID 12996560) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate |
| PubChem CID | 12996560 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O3/c1-15(2,3)18-14(17)12-9-11(12)13(16)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | SYLDGGLSKQADTC-RYUDHWBXSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
The IUPAC name of trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate (CID 12996560) is trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate.
What is the SMILES notation for trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
The canonical SMILES for trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate is CC(C)(C)OC(=O)[C@H]1C[C@@H]1C(=O)c1ccccc1.
What is the InChIKey of trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
The InChIKey is SYLDGGLSKQADTC-RYUDHWBXSA-N. The full InChI is InChI=1S/C15H18O3/c1-15(2,3)18-14(17)12-9-11(12)13(16)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3/t11-,12-/m0/s1.
What are the key properties of trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate has a molecular weight of 246.31 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-tert-butyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate is sourced from PubChem (CID 12996560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).