About trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate
trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate (PubChem CID 101048747) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate |
| PubChem CID | 101048747 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)[C@H]1C[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O3/c22-19(16-4-2-1-3-5-16)17-9-18(17)20(23)24-21-10-13-6-14(11-21)8-15(7-13)12-21/h1-5,13-15,17-18H,6-12H2/t13?,14?,15?,17-,18-,21?/m0/s1 |
| InChIKey | NQCNZYNIEKNLGG-QUUFEMHMSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
The IUPAC name of trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate (CID 101048747) is trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate.
What is the SMILES notation for trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
The canonical SMILES for trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate is O=C(OC12CC3CC(CC(C3)C1)C2)[C@H]1C[C@@H]1C(=O)c1ccccc1.
What is the InChIKey of trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
The InChIKey is NQCNZYNIEKNLGG-QUUFEMHMSA-N. The full InChI is InChI=1S/C21H24O3/c22-19(16-4-2-1-3-5-16)17-9-18(17)20(23)24-21-10-13-6-14(11-21)8-15(7-13)12-21/h1-5,13-15,17-18H,6-12H2/t13?,14?,15?,17-,18-,21?/m0/s1.
What are the key properties of trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate?
trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate has a molecular weight of 324.42 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-1-adamantyl (1S,2S)-2-benzoylcyclopropane-1-carboxylate is sourced from PubChem (CID 101048747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).