C13H15NO3 — CID 102245107
trans-(1S,2S)-2-benzoyl-N-methoxy-N-methylcyclopropane-1-carboxamide (PubChem CID 102245107) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is trans-(1S,2S)-2-benzoyl-N-methoxy-N-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-benzoyl-N-methoxy-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 102245107 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | trans-(1S,2S)-2-benzoyl-N-methoxy-N-methylcyclopropane-1-carboxamide |
| SMILES | CON(C)C(=O)[C@H]1C[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c1-14(17-2)13(16)11-8-10(11)12(15)9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | YYGDUQGXQGXWAK-QWRGUYRKSA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|