About 1-adamantyl benzoate
1-adamantyl benzoate (PubChem CID 2753105) has the molecular formula C17H20O2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-adamantyl benzoate.
Molecular Properties
| Compound Name | 1-adamantyl benzoate |
| PubChem CID | 2753105 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-adamantyl benzoate |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c18-16(15-4-2-1-3-5-15)19-17-9-12-6-13(10-17)8-14(7-12)11-17/h1-5,12-14H,6-11H2 |
| InChIKey | AXXPCBBSENYSJY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl benzoate?
The IUPAC name of 1-adamantyl benzoate (CID 2753105) is 1-adamantyl benzoate.
What is the SMILES notation for 1-adamantyl benzoate?
The canonical SMILES for 1-adamantyl benzoate is O=C(OC12CC3CC(CC(C3)C1)C2)c1ccccc1.
What is the InChIKey of 1-adamantyl benzoate?
The InChIKey is AXXPCBBSENYSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2/c18-16(15-4-2-1-3-5-15)19-17-9-12-6-13(10-17)8-14(7-12)11-17/h1-5,12-14H,6-11H2.
What are the key properties of 1-adamantyl benzoate?
1-adamantyl benzoate has a molecular weight of 256.34 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl benzoate is sourced from PubChem (CID 2753105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).