C33H33NO6 — CID 12067628
[5-[(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl]oxy-2-adamantyl] benzoate (PubChem CID 12067628) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is [5-[(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl]oxy-2-adamantyl] benzoate.
| Compound Name | [5-[(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl]oxy-2-adamantyl] benzoate |
|---|---|
| PubChem CID | 12067628 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | [5-[(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl]oxy-2-adamantyl] benzoate |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@@H](O)C(=O)OC12CC3CC(C1)C(OC(=O)c1ccccc1)C(C3)C2)c1ccccc1 |
| InChI | InChI=1S/C33H33NO6/c35-28(27(22-10-4-1-5-11-22)34-30(36)23-12-6-2-7-13-23)32(38)40-33-18-21-16-25(19-33)29(26(17-21)20-33)39-31(37)24-14-8-3-9-15-24/h1-15,21,25-29,35H,16-20H2,(H,34,36)/t21?,25?,26?,27-,28+,29?,33?/m0/s1 |
| InChIKey | CLBPTHMTTXIXFV-BOZBCNRDSA-N |
| XLogP | 4.87 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |